C45H51O6P — CID 11366101
10-O-benzyl 1-O-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2E,4R,8E)-4-diphenylphosphoryloxydeca-2,8-dienedioate (PubChem CID 11366101) has the molecular formula C45H51O6P and a molecular weight of 718.87 g/mol. Its IUPAC name is 10-O-benzyl 1-O-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2E,4R,8E)-4-diphenylphosphoryloxydeca-2,8-dienedioate.
| Compound Name | 10-O-benzyl 1-O-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2E,4R,8E)-4-diphenylphosphoryloxydeca-2,8-dienedioate |
|---|---|
| PubChem CID | 11366101 |
| Molecular Formula | C45H51O6P |
| Molecular Weight | 718.87 g/mol |
| Exact Mass | 718.34 |
| IUPAC Name | 10-O-benzyl 1-O-[(1R,2S,5R)-5-methyl-2-(2-phenylpropan-2-yl)cyclohexyl] (2E,4R,8E)-4-diphenylphosphoryloxydeca-2,8-dienedioate |
| SMILES | C[C@@H]1CC[C@@H](C(C)(C)c2ccccc2)[C@H](OC(=O)/C=C/[C@@H](CCC/C=C/C(=O)OCc2ccccc2)OP(=O)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C45H51O6P/c1-35-29-31-41(45(2,3)37-21-11-5-12-22-37)42(33-35)50-44(47)32-30-38(23-13-6-18-28-43(46)49-34-36-19-9-4-10-20-36)51-52(48,39-24-14-7-15-25-39)40-26-16-8-17-27-40/h4-5,7-12,14-22,24-28,30,32,35,38,41-42H,6,13,23,29,31,33-34H2,1-3H3/b28-18+,32-30+/t35-,38-,41-,42-/m1/s1 |
| InChIKey | YFMBWYMZLHDUDO-GMMMLHJLSA-N |
| XLogP | 9.65 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.87 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|