C12H9N3S — CID 10577431
5-methyl-1H-pyrimido[4,5-b]quinoline-2-thione (PubChem CID 10577431) has the molecular formula C12H9N3S and a molecular weight of 227.29 g/mol. Its IUPAC name is 5-methyl-1H-pyrimido[4,5-b]quinoline-2-thione.
| Compound Name | 5-methyl-1H-pyrimido[4,5-b]quinoline-2-thione |
|---|---|
| PubChem CID | 10577431 |
| Molecular Formula | C12H9N3S |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 5-methyl-1H-pyrimido[4,5-b]quinoline-2-thione |
| SMILES | Cc1c2ccccc2nc2[nH]c(=S)ncc12 |
| InChI | InChI=1S/C12H9N3S/c1-7-8-4-2-3-5-10(8)14-11-9(7)6-13-12(16)15-11/h2-6H,1H3,(H,13,14,15,16) |
| InChIKey | DQCIKTOLMJQMKS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|