C19H15HgN3S — CID 15968632
(4-methylphenyl)mercury(1+);5-methylpyrimido[4,5-b]quinoline-2-thiolate (PubChem CID 15968632) has the molecular formula C19H15HgN3S and a molecular weight of 518.01 g/mol. Its IUPAC name is (4-methylphenyl)mercury(1+);5-methylpyrimido[4,5-b]quinoline-2-thiolate.
| Compound Name | (4-methylphenyl)mercury(1+);5-methylpyrimido[4,5-b]quinoline-2-thiolate |
|---|---|
| PubChem CID | 15968632 |
| Molecular Formula | C19H15HgN3S |
| Molecular Weight | 518.01 g/mol |
| Exact Mass | 519.07 |
| IUPAC Name | (4-methylphenyl)mercury(1+);5-methylpyrimido[4,5-b]quinoline-2-thiolate |
| SMILES | Cc1c2ccccc2nc2nc([S-])ncc12.Cc1ccc([Hg+])cc1 |
| InChI | InChI=1S/C12H9N3S.C7H7.Hg/c1-7-8-4-2-3-5-10(8)14-11-9(7)6-13-12(16)15-11;1-7-5-3-2-4-6-7;/h2-6H,1H3,(H,13,14,15,16);3-6H,1H3;/q;;+1/p-1 |
| InChIKey | JEDJMMUGRCKELC-UHFFFAOYSA-M |
| XLogP | 3.56 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.01 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|