C10H7N3Se — CID 11557837
9-methylselenadiazolo[4,5-b]quinoline (PubChem CID 11557837) has the molecular formula C10H7N3Se and a molecular weight of 248.15 g/mol. Its IUPAC name is 9-methylselenadiazolo[4,5-b]quinoline.
| Compound Name | 9-methylselenadiazolo[4,5-b]quinoline |
|---|---|
| PubChem CID | 11557837 |
| Molecular Formula | C10H7N3Se |
| Molecular Weight | 248.15 g/mol |
| Exact Mass | 248.98 |
| IUPAC Name | 9-methylselenadiazolo[4,5-b]quinoline |
| SMILES | Cc1c2ccccc2nc2nn[se]c12 |
| InChI | InChI=1S/C10H7N3Se/c1-6-7-4-2-3-5-8(7)11-10-9(6)14-13-12-10/h2-5H,1H3 |
| InChIKey | CBUVIQMIFHFRHC-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.15 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|