About azane;3,4-dimethylcinnoline
azane;3,4-dimethylcinnoline (PubChem CID 174582634) has the molecular formula C10H13N3
and a molecular weight of 175.23 g/mol. Its IUPAC name is azane;3,4-dimethylcinnoline.
Molecular Properties
| Compound Name | azane;3,4-dimethylcinnoline |
| PubChem CID | 174582634 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | azane;3,4-dimethylcinnoline |
| SMILES | Cc1nnc2ccccc2c1C.N |
| InChI | InChI=1S/C10H10N2.H3N/c1-7-8(2)11-12-10-6-4-3-5-9(7)10;/h3-6H,1-2H3;1H3 |
| InChIKey | AULGLNRJAQRTLG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 60.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azane;3,4-dimethylcinnoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;3,4-dimethylcinnoline?
The IUPAC name of azane;3,4-dimethylcinnoline (CID 174582634) is azane;3,4-dimethylcinnoline.
What is the SMILES notation for azane;3,4-dimethylcinnoline?
The canonical SMILES for azane;3,4-dimethylcinnoline is Cc1nnc2ccccc2c1C.N.
What is the InChIKey of azane;3,4-dimethylcinnoline?
The InChIKey is AULGLNRJAQRTLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2.H3N/c1-7-8(2)11-12-10-6-4-3-5-9(7)10;/h3-6H,1-2H3;1H3.
What are the key properties of azane;3,4-dimethylcinnoline?
azane;3,4-dimethylcinnoline has a molecular weight of 175.23 g/mol, XLogP of 2.41, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;3,4-dimethylcinnoline is sourced from PubChem (CID 174582634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).