C30H54O5Si — CID 10577952
(6E,8S,9R,11Z)-9-acetyl-5-[tert-butyl(dimethyl)silyl]oxy-8-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]heptadeca-6,11-dienal (PubChem CID 10577952) has the molecular formula C30H54O5Si and a molecular weight of 522.84 g/mol. Its IUPAC name is (6E,8S,9R,11Z)-9-acetyl-5-[tert-butyl(dimethyl)silyl]oxy-8-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]heptadeca-6,11-dienal.
| Compound Name | (6E,8S,9R,11Z)-9-acetyl-5-[tert-butyl(dimethyl)silyl]oxy-8-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]heptadeca-6,11-dienal |
|---|---|
| PubChem CID | 10577952 |
| Molecular Formula | C30H54O5Si |
| Molecular Weight | 522.84 g/mol |
| Exact Mass | 522.37 |
| IUPAC Name | (6E,8S,9R,11Z)-9-acetyl-5-[tert-butyl(dimethyl)silyl]oxy-8-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]heptadeca-6,11-dienal |
| SMILES | CCCCC/C=C\C[C@@H](C(C)=O)[C@H](/C=C/C(CCCC=O)O[Si](C)(C)C(C)(C)C)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C30H54O5Si/c1-10-11-12-13-14-15-19-26(24(2)32)27(28-23-33-30(6,7)34-28)21-20-25(18-16-17-22-31)35-36(8,9)29(3,4)5/h14-15,20-22,25-28H,10-13,16-19,23H2,1-9H3/b15-14-,21-20+/t25?,26-,27-,28+/m0/s1 |
| InChIKey | CXAATJYQJPQEEU-YWNUDCHOSA-N |
| XLogP | 7.80 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.84 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|