C35H31Cl2N5O2 — CID 10579792
2-chloro-N-[3-[3-[(2-chloroacridine-4-carbonyl)amino]propyl-methylamino]propyl]acridine-4-carboxamide (PubChem CID 10579792) has the molecular formula C35H31Cl2N5O2 and a molecular weight of 624.57 g/mol. Its IUPAC name is 2-chloro-N-[3-[3-[(2-chloroacridine-4-carbonyl)amino]propyl-methylamino]propyl]acridine-4-carboxamide.
| Compound Name | 2-chloro-N-[3-[3-[(2-chloroacridine-4-carbonyl)amino]propyl-methylamino]propyl]acridine-4-carboxamide |
|---|---|
| PubChem CID | 10579792 |
| Molecular Formula | C35H31Cl2N5O2 |
| Molecular Weight | 624.57 g/mol |
| Exact Mass | 623.19 |
| IUPAC Name | 2-chloro-N-[3-[3-[(2-chloroacridine-4-carbonyl)amino]propyl-methylamino]propyl]acridine-4-carboxamide |
| SMILES | CN(CCCNC(=O)c1cc(Cl)cc2cc3ccccc3nc12)CCCNC(=O)c1cc(Cl)cc2cc3ccccc3nc12 |
| InChI | InChI=1S/C35H31Cl2N5O2/c1-42(14-6-12-38-34(43)28-20-26(36)18-24-16-22-8-2-4-10-30(22)40-32(24)28)15-7-13-39-35(44)29-21-27(37)19-25-17-23-9-3-5-11-31(23)41-33(25)29/h2-5,8-11,16-21H,6-7,12-15H2,1H3,(H,38,43)(H,39,44) |
| InChIKey | ZGVHRUSZUUYPKK-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.57 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|