About 2,5-dioxo-4,6,7,8-tetrahydro-3H-chromene-7-carboxylic acid
2,5-dioxo-4,6,7,8-tetrahydro-3H-chromene-7-carboxylic acid (PubChem CID 10584550) has the molecular formula C10H10O5
and a molecular weight of 210.18 g/mol. Its IUPAC name is 2,5-dioxo-4,6,7,8-tetrahydro-3H-chromene-7-carboxylic acid.
Analyze 2,5-dioxo-4,6,7,8-tetrahydro-3H-chromene-7-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dioxo-4,6,7,8-tetrahydro-3H-chromene-7-carboxylic acid?
The IUPAC name of 2,5-dioxo-4,6,7,8-tetrahydro-3H-chromene-7-carboxylic acid (CID 10584550) is 2,5-dioxo-4,6,7,8-tetrahydro-3H-chromene-7-carboxylic acid.
What is the SMILES notation for 2,5-dioxo-4,6,7,8-tetrahydro-3H-chromene-7-carboxylic acid?
The canonical SMILES for 2,5-dioxo-4,6,7,8-tetrahydro-3H-chromene-7-carboxylic acid is O=C1CCC2=C(CC(C(=O)O)CC2=O)O1.
What is the InChIKey of 2,5-dioxo-4,6,7,8-tetrahydro-3H-chromene-7-carboxylic acid?
The InChIKey is LQOONMZTPYCLIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O5/c11-7-3-5(10(13)14)4-8-6(7)1-2-9(12)15-8/h5H,1-4H2,(H,13,14).
What are the key properties of 2,5-dioxo-4,6,7,8-tetrahydro-3H-chromene-7-carboxylic acid?
2,5-dioxo-4,6,7,8-tetrahydro-3H-chromene-7-carboxylic acid has a molecular weight of 210.18 g/mol, XLogP of 0.64, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dioxo-4,6,7,8-tetrahydro-3H-chromene-7-carboxylic acid is sourced from PubChem (CID 10584550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).