C15H22O — CID 10584936
(Z)-3-[(3R,3aR,6aS)-3,4,6,6-tetramethyl-1,2,3,6a-tetrahydropentalen-3a-yl]prop-2-enal (PubChem CID 10584936) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is (Z)-3-[(3R,3aR,6aS)-3,4,6,6-tetramethyl-1,2,3,6a-tetrahydropentalen-3a-yl]prop-2-enal.
| Compound Name | (Z)-3-[(3R,3aR,6aS)-3,4,6,6-tetramethyl-1,2,3,6a-tetrahydropentalen-3a-yl]prop-2-enal |
|---|---|
| PubChem CID | 10584936 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | (Z)-3-[(3R,3aR,6aS)-3,4,6,6-tetramethyl-1,2,3,6a-tetrahydropentalen-3a-yl]prop-2-enal |
| SMILES | CC1=CC(C)(C)[C@@H]2CC[C@@H](C)[C@]12/C=C\C=O |
| InChI | InChI=1S/C15H22O/c1-11-6-7-13-14(3,4)10-12(2)15(11,13)8-5-9-16/h5,8-11,13H,6-7H2,1-4H3/b8-5+/t11-,13+,15-/m1/s1 |
| InChIKey | KIKWLDHFSIKNAL-WNFJFBCBSA-N |
| XLogP | 3.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|