C11H12ClNO2 — CID 10585306
(4Z)-6-chloro-4-ethylidene-8-methoxy-1H-pyrano[3,4-c]pyridine (PubChem CID 10585306) has the molecular formula C11H12ClNO2 and a molecular weight of 225.67 g/mol. Its IUPAC name is (4Z)-6-chloro-4-ethylidene-8-methoxy-1H-pyrano[3,4-c]pyridine.
| Compound Name | (4Z)-6-chloro-4-ethylidene-8-methoxy-1H-pyrano[3,4-c]pyridine |
|---|---|
| PubChem CID | 10585306 |
| Molecular Formula | C11H12ClNO2 |
| Molecular Weight | 225.67 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | (4Z)-6-chloro-4-ethylidene-8-methoxy-1H-pyrano[3,4-c]pyridine |
| SMILES | C/C=C1\COCc2c1cc(Cl)nc2OC |
| InChI | InChI=1S/C11H12ClNO2/c1-3-7-5-15-6-9-8(7)4-10(12)13-11(9)14-2/h3-4H,5-6H2,1-2H3/b7-3+ |
| InChIKey | NBESTMKMEZSWAV-XVNBXDOJSA-N |
| XLogP | 2.68 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.67 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|