C12H21NO3 — CID 10585407
(2E)-4-(3-hydroxypropyl)-N-methoxy-N-methylhepta-2,6-dienamide (PubChem CID 10585407) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is (2E)-4-(3-hydroxypropyl)-N-methoxy-N-methylhepta-2,6-dienamide.
| Compound Name | (2E)-4-(3-hydroxypropyl)-N-methoxy-N-methylhepta-2,6-dienamide |
|---|---|
| PubChem CID | 10585407 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | (2E)-4-(3-hydroxypropyl)-N-methoxy-N-methylhepta-2,6-dienamide |
| SMILES | C=CCC(/C=C/C(=O)N(C)OC)CCCO |
| InChI | InChI=1S/C12H21NO3/c1-4-6-11(7-5-10-14)8-9-12(15)13(2)16-3/h4,8-9,11,14H,1,5-7,10H2,2-3H3/b9-8+ |
| InChIKey | WVOSYJNSZKQIAB-CMDGGOBGSA-N |
| XLogP | 1.53 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|