C10H19NO3 — CID 10035716
(E)-5-hydroxy-N-methoxy-N,6-dimethylhept-2-enamide (PubChem CID 10035716) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is (E)-5-hydroxy-N-methoxy-N,6-dimethylhept-2-enamide.
| Compound Name | (E)-5-hydroxy-N-methoxy-N,6-dimethylhept-2-enamide |
|---|---|
| PubChem CID | 10035716 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | (E)-5-hydroxy-N-methoxy-N,6-dimethylhept-2-enamide |
| SMILES | CON(C)C(=O)/C=C/CC(O)C(C)C |
| InChI | InChI=1S/C10H19NO3/c1-8(2)9(12)6-5-7-10(13)11(3)14-4/h5,7-9,12H,6H2,1-4H3/b7-5+ |
| InChIKey | YJMFOLGTZACIEL-FNORWQNLSA-N |
| XLogP | 0.97 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|