About (E)-N-methoxy-N,4-dimethylhept-2-enamide
(E)-N-methoxy-N,4-dimethylhept-2-enamide (PubChem CID 130453610) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is (E)-N-methoxy-N,4-dimethylhept-2-enamide.
Molecular Properties
| Compound Name | (E)-N-methoxy-N,4-dimethylhept-2-enamide |
| PubChem CID | 130453610 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | (E)-N-methoxy-N,4-dimethylhept-2-enamide |
| SMILES | CCCC(C)/C=C/C(=O)N(C)OC |
| InChI | InChI=1S/C10H19NO2/c1-5-6-9(2)7-8-10(12)11(3)13-4/h7-9H,5-6H2,1-4H3/b8-7+ |
| InChIKey | AMOBNUYOJOBADT-BQYQJAHWSA-N |
| XLogP | 2.00 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-methoxy-N,4-dimethylhept-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-methoxy-N,4-dimethylhept-2-enamide?
The IUPAC name of (E)-N-methoxy-N,4-dimethylhept-2-enamide (CID 130453610) is (E)-N-methoxy-N,4-dimethylhept-2-enamide.
What is the SMILES notation for (E)-N-methoxy-N,4-dimethylhept-2-enamide?
The canonical SMILES for (E)-N-methoxy-N,4-dimethylhept-2-enamide is CCCC(C)/C=C/C(=O)N(C)OC.
What is the InChIKey of (E)-N-methoxy-N,4-dimethylhept-2-enamide?
The InChIKey is AMOBNUYOJOBADT-BQYQJAHWSA-N. The full InChI is InChI=1S/C10H19NO2/c1-5-6-9(2)7-8-10(12)11(3)13-4/h7-9H,5-6H2,1-4H3/b8-7+.
What are the key properties of (E)-N-methoxy-N,4-dimethylhept-2-enamide?
(E)-N-methoxy-N,4-dimethylhept-2-enamide has a molecular weight of 185.27 g/mol, XLogP of 2.00, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-methoxy-N,4-dimethylhept-2-enamide is sourced from PubChem (CID 130453610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).