C15H21NO — CID 10585628
(1R,4Z,8R)-8-(N-methylanilino)cyclooct-4-en-1-ol (PubChem CID 10585628) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is (1R,4Z,8R)-8-(N-methylanilino)cyclooct-4-en-1-ol.
| Compound Name | (1R,4Z,8R)-8-(N-methylanilino)cyclooct-4-en-1-ol |
|---|---|
| PubChem CID | 10585628 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | (1R,4Z,8R)-8-(N-methylanilino)cyclooct-4-en-1-ol |
| SMILES | CN(c1ccccc1)[C@@H]1CC/C=C\CC[C@H]1O |
| InChI | InChI=1S/C15H21NO/c1-16(13-9-5-4-6-10-13)14-11-7-2-3-8-12-15(14)17/h2-6,9-10,14-15,17H,7-8,11-12H2,1H3/b3-2-/t14-,15-/m1/s1 |
| InChIKey | NQWALIODAFRWHP-OKYAQOQYSA-N |
| XLogP | 2.98 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|