C15H20N2O2 — CID 71014615
[(4E)-8-aminocyclooct-4-en-1-yl]-phenylcarbamic acid (PubChem CID 71014615) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is [(4E)-8-aminocyclooct-4-en-1-yl]-phenylcarbamic acid.
| Compound Name | [(4E)-8-aminocyclooct-4-en-1-yl]-phenylcarbamic acid |
|---|---|
| PubChem CID | 71014615 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | [(4E)-8-aminocyclooct-4-en-1-yl]-phenylcarbamic acid |
| SMILES | NC1CC/C=C\CCC1N(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C15H20N2O2/c16-13-10-6-1-2-7-11-14(13)17(15(18)19)12-8-4-3-5-9-12/h1-5,8-9,13-14H,6-7,10-11,16H2,(H,18,19)/b2-1- |
| InChIKey | OYFWQAFECYZJBN-UPHRSURJSA-N |
| XLogP | 3.00 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|