About 2-phenylethyl 2-formylbenzoate
2-phenylethyl 2-formylbenzoate (PubChem CID 10587030) has the molecular formula C16H14O3
and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-phenylethyl 2-formylbenzoate.
Molecular Properties
| Compound Name | 2-phenylethyl 2-formylbenzoate |
| PubChem CID | 10587030 |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 2-phenylethyl 2-formylbenzoate |
| SMILES | O=Cc1ccccc1C(=O)OCCc1ccccc1 |
| InChI | InChI=1S/C16H14O3/c17-12-14-8-4-5-9-15(14)16(18)19-11-10-13-6-2-1-3-7-13/h1-9,12H,10-11H2 |
| InChIKey | KQNMLAVTNUFBMY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylethyl 2-formylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethyl 2-formylbenzoate?
The IUPAC name of 2-phenylethyl 2-formylbenzoate (CID 10587030) is 2-phenylethyl 2-formylbenzoate.
What is the SMILES notation for 2-phenylethyl 2-formylbenzoate?
The canonical SMILES for 2-phenylethyl 2-formylbenzoate is O=Cc1ccccc1C(=O)OCCc1ccccc1.
What is the InChIKey of 2-phenylethyl 2-formylbenzoate?
The InChIKey is KQNMLAVTNUFBMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O3/c17-12-14-8-4-5-9-15(14)16(18)19-11-10-13-6-2-1-3-7-13/h1-9,12H,10-11H2.
What are the key properties of 2-phenylethyl 2-formylbenzoate?
2-phenylethyl 2-formylbenzoate has a molecular weight of 254.29 g/mol, XLogP of 2.90, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethyl 2-formylbenzoate is sourced from PubChem (CID 10587030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).