C15H17ClO5 — CID 139521366
[4-(chloromethoxy)-3,3-dimethyl-4-oxobutyl] 2-formylbenzoate (PubChem CID 139521366) has the molecular formula C15H17ClO5 and a molecular weight of 312.75 g/mol. Its IUPAC name is [4-(chloromethoxy)-3,3-dimethyl-4-oxobutyl] 2-formylbenzoate.
| Compound Name | [4-(chloromethoxy)-3,3-dimethyl-4-oxobutyl] 2-formylbenzoate |
|---|---|
| PubChem CID | 139521366 |
| Molecular Formula | C15H17ClO5 |
| Molecular Weight | 312.75 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | [4-(chloromethoxy)-3,3-dimethyl-4-oxobutyl] 2-formylbenzoate |
| SMILES | CC(C)(CCOC(=O)c1ccccc1C=O)C(=O)OCCl |
| InChI | InChI=1S/C15H17ClO5/c1-15(2,14(19)21-10-16)7-8-20-13(18)12-6-4-3-5-11(12)9-17/h3-6,9H,7-8,10H2,1-2H3 |
| InChIKey | RTUCQEIRRALXJB-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.75 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|