C13H26O3Si — CID 10587331
(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-ethyloxolan-2-one (PubChem CID 10587331) has the molecular formula C13H26O3Si and a molecular weight of 258.43 g/mol. Its IUPAC name is (4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-ethyloxolan-2-one.
| Compound Name | (4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-ethyloxolan-2-one |
|---|---|
| PubChem CID | 10587331 |
| Molecular Formula | C13H26O3Si |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | (4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-ethyloxolan-2-one |
| SMILES | CC[C@H]1CC(=O)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H26O3Si/c1-7-10-8-12(14)16-11(10)9-15-17(5,6)13(2,3)4/h10-11H,7-9H2,1-6H3/t10-,11+/m0/s1 |
| InChIKey | LRDYTXIKPYGGRR-WDEREUQCSA-N |
| XLogP | 3.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|