C11H17N3O6 — CID 10589353
2-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-propyl-1,2,4-triazine-3,5-dione (PubChem CID 10589353) has the molecular formula C11H17N3O6 and a molecular weight of 287.27 g/mol. Its IUPAC name is 2-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-propyl-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-propyl-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 10589353 |
| Molecular Formula | C11H17N3O6 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 2-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-propyl-1,2,4-triazine-3,5-dione |
| SMILES | CCCc1nn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H17N3O6/c1-2-3-5-9(18)12-11(19)14(13-5)10-8(17)7(16)6(4-15)20-10/h6-8,10,15-17H,2-4H2,1H3,(H,12,18,19)/t6-,7-,8-,10-/m1/s1 |
| InChIKey | DTRJPEYEHVYXMS-FDDDBJFASA-N |
| XLogP | -2.50 |
| TPSA | 137.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |