C12H13N3O7 — CID 121006824
2-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(furan-3-yl)-1,2,4-triazine-3,5-dione (PubChem CID 121006824) has the molecular formula C12H13N3O7 and a molecular weight of 311.25 g/mol. Its IUPAC name is 2-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(furan-3-yl)-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(furan-3-yl)-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 121006824 |
| Molecular Formula | C12H13N3O7 |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 2-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(furan-3-yl)-1,2,4-triazine-3,5-dione |
| SMILES | O=c1[nH]c(=O)n([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)nc1-c1ccoc1 |
| InChI | InChI=1S/C12H13N3O7/c16-3-6-8(17)9(18)11(22-6)15-12(20)13-10(19)7(14-15)5-1-2-21-4-5/h1-2,4,6,8-9,11,16-18H,3H2,(H,13,19,20)/t6-,8-,9-,11-/m1/s1 |
| InChIKey | HOKXUNHVSRURDN-PNHWDRBUSA-N |
| XLogP | -2.20 |
| TPSA | 150.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |