C16H28O5 — CID 10590344
3,10-ditert-butyl-2,4,9,11,13-pentaoxadispiro[5.0.57.16]tridecane (PubChem CID 10590344) has the molecular formula C16H28O5 and a molecular weight of 300.40 g/mol. Its IUPAC name is 3,10-ditert-butyl-2,4,9,11,13-pentaoxadispiro[5.0.57.16]tridecane.
| Compound Name | 3,10-ditert-butyl-2,4,9,11,13-pentaoxadispiro[5.0.57.16]tridecane |
|---|---|
| PubChem CID | 10590344 |
| Molecular Formula | C16H28O5 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | 3,10-ditert-butyl-2,4,9,11,13-pentaoxadispiro[5.0.57.16]tridecane |
| SMILES | CC(C)(C)C1OCC2(CO1)OC21COC(C(C)(C)C)OC1 |
| InChI | InChI=1S/C16H28O5/c1-13(2,3)11-17-7-15(8-18-11)16(21-15)9-19-12(20-10-16)14(4,5)6/h11-12H,7-10H2,1-6H3 |
| InChIKey | XMTRTIYBTMHEET-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|