C17H24N4OSi — CID 10592406
2,2-dimethyl-N-[4-methyl-5-(2-trimethylsilylethynyl)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]propanamide (PubChem CID 10592406) has the molecular formula C17H24N4OSi and a molecular weight of 328.49 g/mol. Its IUPAC name is 2,2-dimethyl-N-[4-methyl-5-(2-trimethylsilylethynyl)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]propanamide.
| Compound Name | 2,2-dimethyl-N-[4-methyl-5-(2-trimethylsilylethynyl)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]propanamide |
|---|---|
| PubChem CID | 10592406 |
| Molecular Formula | C17H24N4OSi |
| Molecular Weight | 328.49 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 2,2-dimethyl-N-[4-methyl-5-(2-trimethylsilylethynyl)-7H-pyrrolo[2,3-d]pyrimidin-2-yl]propanamide |
| SMILES | Cc1nc(NC(=O)C(C)(C)C)nc2[nH]cc(C#C[Si](C)(C)C)c12 |
| InChI | InChI=1S/C17H24N4OSi/c1-11-13-12(8-9-23(5,6)7)10-18-14(13)20-16(19-11)21-15(22)17(2,3)4/h10H,1-7H3,(H2,18,19,20,21,22) |
| InChIKey | XUQMKBOHOIMGFS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|