C22H21NO4 — CID 10594880
(4S)-4-benzyl-3-(5-phenylmethoxypent-2-ynoyl)-1,3-oxazolidin-2-one (PubChem CID 10594880) has the molecular formula C22H21NO4 and a molecular weight of 363.41 g/mol. Its IUPAC name is (4S)-4-benzyl-3-(5-phenylmethoxypent-2-ynoyl)-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-(5-phenylmethoxypent-2-ynoyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10594880 |
| Molecular Formula | C22H21NO4 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | (4S)-4-benzyl-3-(5-phenylmethoxypent-2-ynoyl)-1,3-oxazolidin-2-one |
| SMILES | O=C(C#CCCOCc1ccccc1)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C22H21NO4/c24-21(13-7-8-14-26-16-19-11-5-2-6-12-19)23-20(17-27-22(23)25)15-18-9-3-1-4-10-18/h1-6,9-12,20H,8,14-17H2/t20-/m0/s1 |
| InChIKey | OVKGGUIFVHPTQX-FQEVSTJZSA-N |
| XLogP | 3.19 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|