C15H23N3O8 — CID 10595495
2-O,2-O-diethyl 3-O-methyl (5Z)-5-(carbamoylhydrazinylidene)-2-oxohexane-2,2,3-tricarboxylate (PubChem CID 10595495) has the molecular formula C15H23N3O8 and a molecular weight of 373.36 g/mol. Its IUPAC name is 2-O,2-O-diethyl 3-O-methyl (5Z)-5-(carbamoylhydrazinylidene)-2-oxohexane-2,2,3-tricarboxylate.
| Compound Name | 2-O,2-O-diethyl 3-O-methyl (5Z)-5-(carbamoylhydrazinylidene)-2-oxohexane-2,2,3-tricarboxylate |
|---|---|
| PubChem CID | 10595495 |
| Molecular Formula | C15H23N3O8 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 2-O,2-O-diethyl 3-O-methyl (5Z)-5-(carbamoylhydrazinylidene)-2-oxohexane-2,2,3-tricarboxylate |
| SMILES | CCOC(=O)C(C(C)=O)(C(=O)OCC)C(C(=O)OC)/C(C)=N\NC(N)=O |
| InChI | InChI=1S/C15H23N3O8/c1-6-25-12(21)15(9(4)19,13(22)26-7-2)10(11(20)24-5)8(3)17-18-14(16)23/h10H,6-7H2,1-5H3,(H3,16,18,23)/b17-8- |
| InChIKey | LHBKFLJMHIIMHZ-IUXPMGMMSA-N |
| XLogP | -0.48 |
| TPSA | 163.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|