C9H18N3O6P — CID 11323884
ethyl (3E)-3-(carbamoylhydrazinylidene)-2-dimethoxyphosphorylbutanoate (PubChem CID 11323884) has the molecular formula C9H18N3O6P and a molecular weight of 295.23 g/mol. Its IUPAC name is ethyl (3E)-3-(carbamoylhydrazinylidene)-2-dimethoxyphosphorylbutanoate.
| Compound Name | ethyl (3E)-3-(carbamoylhydrazinylidene)-2-dimethoxyphosphorylbutanoate |
|---|---|
| PubChem CID | 11323884 |
| Molecular Formula | C9H18N3O6P |
| Molecular Weight | 295.23 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | ethyl (3E)-3-(carbamoylhydrazinylidene)-2-dimethoxyphosphorylbutanoate |
| SMILES | CCOC(=O)C(/C(C)=N/NC(N)=O)P(=O)(OC)OC |
| InChI | InChI=1S/C9H18N3O6P/c1-5-18-8(13)7(19(15,16-3)17-4)6(2)11-12-9(10)14/h7H,5H2,1-4H3,(H3,10,12,14)/b11-6+ |
| InChIKey | ZQYBDPWIVAISCE-IZZDOVSWSA-N |
| XLogP | 0.45 |
| TPSA | 129.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.23 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|