C24H33N3O — CID 10595902
1-[(1S)-1-phenylethyl]-3-[(1S)-1-(2-piperidin-1-ylphenyl)butyl]urea (PubChem CID 10595902) has the molecular formula C24H33N3O and a molecular weight of 379.55 g/mol. Its IUPAC name is 1-[(1S)-1-phenylethyl]-3-[(1S)-1-(2-piperidin-1-ylphenyl)butyl]urea.
| Compound Name | 1-[(1S)-1-phenylethyl]-3-[(1S)-1-(2-piperidin-1-ylphenyl)butyl]urea |
|---|---|
| PubChem CID | 10595902 |
| Molecular Formula | C24H33N3O |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.26 |
| IUPAC Name | 1-[(1S)-1-phenylethyl]-3-[(1S)-1-(2-piperidin-1-ylphenyl)butyl]urea |
| SMILES | CCC[C@H](NC(=O)N[C@@H](C)c1ccccc1)c1ccccc1N1CCCCC1 |
| InChI | InChI=1S/C24H33N3O/c1-3-12-22(26-24(28)25-19(2)20-13-6-4-7-14-20)21-15-8-9-16-23(21)27-17-10-5-11-18-27/h4,6-9,13-16,19,22H,3,5,10-12,17-18H2,1-2H3,(H2,25,26,28)/t19-,22-/m0/s1 |
| InChIKey | SXDDODRZKXPUGY-UGKGYDQZSA-N |
| XLogP | 5.58 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |