C25H32N2O3 — CID 54156305
4-[2-[1-[2-(4-methylpiperidin-1-yl)phenyl]butylamino]-2-oxoethyl]benzoic acid (PubChem CID 54156305) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is 4-[2-[1-[2-(4-methylpiperidin-1-yl)phenyl]butylamino]-2-oxoethyl]benzoic acid.
| Compound Name | 4-[2-[1-[2-(4-methylpiperidin-1-yl)phenyl]butylamino]-2-oxoethyl]benzoic acid |
|---|---|
| PubChem CID | 54156305 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | 4-[2-[1-[2-(4-methylpiperidin-1-yl)phenyl]butylamino]-2-oxoethyl]benzoic acid |
| SMILES | CCCC(NC(=O)Cc1ccc(C(=O)O)cc1)c1ccccc1N1CCC(C)CC1 |
| InChI | InChI=1S/C25H32N2O3/c1-3-6-22(26-24(28)17-19-9-11-20(12-10-19)25(29)30)21-7-4-5-8-23(21)27-15-13-18(2)14-16-27/h4-5,7-12,18,22H,3,6,13-17H2,1-2H3,(H,26,28)(H,29,30) |
| InChIKey | OLHAOOMSVZDVKE-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |