C18H22OSe2 — CID 10597762
(2R,3S)-2,3-dimethyl-4,4-bis(phenylselanyl)butan-1-ol (PubChem CID 10597762) has the molecular formula C18H22OSe2 and a molecular weight of 412.29 g/mol. Its IUPAC name is (2R,3S)-2,3-dimethyl-4,4-bis(phenylselanyl)butan-1-ol.
| Compound Name | (2R,3S)-2,3-dimethyl-4,4-bis(phenylselanyl)butan-1-ol |
|---|---|
| PubChem CID | 10597762 |
| Molecular Formula | C18H22OSe2 |
| Molecular Weight | 412.29 g/mol |
| Exact Mass | 414.00 |
| IUPAC Name | (2R,3S)-2,3-dimethyl-4,4-bis(phenylselanyl)butan-1-ol |
| SMILES | C[C@H](C([Se]c1ccccc1)[Se]c1ccccc1)[C@@H](C)CO |
| InChI | InChI=1S/C18H22OSe2/c1-14(13-19)15(2)18(20-16-9-5-3-6-10-16)21-17-11-7-4-8-12-17/h3-12,14-15,18-19H,13H2,1-2H3/t14-,15-/m0/s1 |
| InChIKey | KOZHHLYBTCDAGL-GJZGRUSLSA-N |
| XLogP | 2.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|