C27H50O2Si — CID 10598979
(4S,7E,11E)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-8,12,16-trimethylheptadeca-7,11,15-trienal (PubChem CID 10598979) has the molecular formula C27H50O2Si and a molecular weight of 434.78 g/mol. Its IUPAC name is (4S,7E,11E)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-8,12,16-trimethylheptadeca-7,11,15-trienal.
| Compound Name | (4S,7E,11E)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-8,12,16-trimethylheptadeca-7,11,15-trienal |
|---|---|
| PubChem CID | 10598979 |
| Molecular Formula | C27H50O2Si |
| Molecular Weight | 434.78 g/mol |
| Exact Mass | 434.36 |
| IUPAC Name | (4S,7E,11E)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-8,12,16-trimethylheptadeca-7,11,15-trienal |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC[C@@H](CCC=O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H50O2Si/c1-23(2)14-10-15-24(3)16-11-17-25(4)18-12-19-26(20-13-21-28)22-29-30(8,9)27(5,6)7/h14,16,18,21,26H,10-13,15,17,19-20,22H2,1-9H3/b24-16+,25-18+/t26-/m0/s1 |
| InChIKey | IWCPARJCSBPFIN-ZGHWVHIESA-N |
| XLogP | 8.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.78 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|