C20H31NO10 — CID 10599451
[(2R,4R,5R)-4-[(1S,2S)-1,2-diacetyloxy-2-[(2S,3R)-3-(diethylcarbamoyl)oxiran-2-yl]ethyl]-2-methyl-1,3-dioxan-5-yl] acetate (PubChem CID 10599451) has the molecular formula C20H31NO10 and a molecular weight of 445.47 g/mol. Its IUPAC name is [(2R,4R,5R)-4-[(1S,2S)-1,2-diacetyloxy-2-[(2S,3R)-3-(diethylcarbamoyl)oxiran-2-yl]ethyl]-2-methyl-1,3-dioxan-5-yl] acetate.
| Compound Name | [(2R,4R,5R)-4-[(1S,2S)-1,2-diacetyloxy-2-[(2S,3R)-3-(diethylcarbamoyl)oxiran-2-yl]ethyl]-2-methyl-1,3-dioxan-5-yl] acetate |
|---|---|
| PubChem CID | 10599451 |
| Molecular Formula | C20H31NO10 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | [(2R,4R,5R)-4-[(1S,2S)-1,2-diacetyloxy-2-[(2S,3R)-3-(diethylcarbamoyl)oxiran-2-yl]ethyl]-2-methyl-1,3-dioxan-5-yl] acetate |
| SMILES | CCN(CC)C(=O)[C@@H]1O[C@H]1[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1O[C@H](C)OC[C@H]1OC(C)=O |
| InChI | InChI=1S/C20H31NO10/c1-7-21(8-2)20(25)19-18(31-19)17(29-12(5)24)16(28-11(4)23)15-14(27-10(3)22)9-26-13(6)30-15/h13-19H,7-9H2,1-6H3/t13-,14-,15-,16+,17-,18+,19-/m1/s1 |
| InChIKey | ADVNHSFYGFJMPP-RHSUQVCWSA-N |
| XLogP | 0.18 |
| TPSA | 130.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|