C10H19NO3 — CID 106004062
(E)-3-(4-propan-2-yloxybutylamino)prop-2-enoic acid (PubChem CID 106004062) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is (E)-3-(4-propan-2-yloxybutylamino)prop-2-enoic acid.
| Compound Name | (E)-3-(4-propan-2-yloxybutylamino)prop-2-enoic acid |
|---|---|
| PubChem CID | 106004062 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | (E)-3-(4-propan-2-yloxybutylamino)prop-2-enoic acid |
| SMILES | CC(C)OCCCCN/C=C/C(=O)O |
| InChI | InChI=1S/C10H19NO3/c1-9(2)14-8-4-3-6-11-7-5-10(12)13/h5,7,9,11H,3-4,6,8H2,1-2H3,(H,12,13)/b7-5+ |
| InChIKey | FXWVHCDDYMISBR-FNORWQNLSA-N |
| XLogP | 1.38 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|