C10H16N2O5 — CID 104762324
(E)-4-oxo-4-(2-propan-2-yloxyethylcarbamoylamino)but-2-enoic acid (PubChem CID 104762324) has the molecular formula C10H16N2O5 and a molecular weight of 244.25 g/mol. Its IUPAC name is (E)-4-oxo-4-(2-propan-2-yloxyethylcarbamoylamino)but-2-enoic acid.
| Compound Name | (E)-4-oxo-4-(2-propan-2-yloxyethylcarbamoylamino)but-2-enoic acid |
|---|---|
| PubChem CID | 104762324 |
| Molecular Formula | C10H16N2O5 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | (E)-4-oxo-4-(2-propan-2-yloxyethylcarbamoylamino)but-2-enoic acid |
| SMILES | CC(C)OCCNC(=O)NC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C10H16N2O5/c1-7(2)17-6-5-11-10(16)12-8(13)3-4-9(14)15/h3-4,7H,5-6H2,1-2H3,(H,14,15)(H2,11,12,13,16)/b4-3+ |
| InChIKey | QPPFXFVHDUTUOM-ONEGZZNKSA-N |
| XLogP | -0.12 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|