C8H11N3O6 — CID 83203258
(E)-4-(2-carbamoyloxyethylcarbamoylamino)-4-oxobut-2-enoic acid (PubChem CID 83203258) has the molecular formula C8H11N3O6 and a molecular weight of 245.19 g/mol. Its IUPAC name is (E)-4-(2-carbamoyloxyethylcarbamoylamino)-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-(2-carbamoyloxyethylcarbamoylamino)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 83203258 |
| Molecular Formula | C8H11N3O6 |
| Molecular Weight | 245.19 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | (E)-4-(2-carbamoyloxyethylcarbamoylamino)-4-oxobut-2-enoic acid |
| SMILES | NC(=O)OCCNC(=O)NC(=O)/C=C/C(=O)O |
| InChI | InChI=1S/C8H11N3O6/c9-7(15)17-4-3-10-8(16)11-5(12)1-2-6(13)14/h1-2H,3-4H2,(H2,9,15)(H,13,14)(H2,10,11,12,16)/b2-1+ |
| InChIKey | XVYBEAGXQQLOQH-OWOJBTEDSA-N |
| XLogP | -1.45 |
| TPSA | 147.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.19 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|