C11H19NO3 — CID 178007868
(Z)-4-oxo-N-(2-propan-2-yloxyethyl)hex-2-enamide (PubChem CID 178007868) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is (Z)-4-oxo-N-(2-propan-2-yloxyethyl)hex-2-enamide.
| Compound Name | (Z)-4-oxo-N-(2-propan-2-yloxyethyl)hex-2-enamide |
|---|---|
| PubChem CID | 178007868 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | (Z)-4-oxo-N-(2-propan-2-yloxyethyl)hex-2-enamide |
| SMILES | CCC(=O)/C=C\C(=O)NCCOC(C)C |
| InChI | InChI=1S/C11H19NO3/c1-4-10(13)5-6-11(14)12-7-8-15-9(2)3/h5-6,9H,4,7-8H2,1-3H3,(H,12,14)/b6-5- |
| InChIKey | ILOYAXPZZNQHKB-WAYWQWQTSA-N |
| XLogP | 1.06 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|