C8H15NO4 — CID 106305455
(E)-3-[3-(2-hydroxyethoxy)propylamino]prop-2-enoic acid (PubChem CID 106305455) has the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. Its IUPAC name is (E)-3-[3-(2-hydroxyethoxy)propylamino]prop-2-enoic acid.
| Compound Name | (E)-3-[3-(2-hydroxyethoxy)propylamino]prop-2-enoic acid |
|---|---|
| PubChem CID | 106305455 |
| Molecular Formula | C8H15NO4 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | (E)-3-[3-(2-hydroxyethoxy)propylamino]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/NCCCOCCO |
| InChI | InChI=1S/C8H15NO4/c10-5-7-13-6-1-3-9-4-2-8(11)12/h2,4,9-10H,1,3,5-7H2,(H,11,12)/b4-2+ |
| InChIKey | HQNUKFBHCZAGSJ-DUXPYHPUSA-N |
| XLogP | -0.43 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|