C14H19Br2NO2S — CID 106012519
2,4-dibromo-N-(3-cyclopentylpropyl)benzenesulfonamide (PubChem CID 106012519) has the molecular formula C14H19Br2NO2S and a molecular weight of 425.19 g/mol. Its IUPAC name is 2,4-dibromo-N-(3-cyclopentylpropyl)benzenesulfonamide.
| Compound Name | 2,4-dibromo-N-(3-cyclopentylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106012519 |
| Molecular Formula | C14H19Br2NO2S |
| Molecular Weight | 425.19 g/mol |
| Exact Mass | 422.95 |
| IUPAC Name | 2,4-dibromo-N-(3-cyclopentylpropyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCCCC1CCCC1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C14H19Br2NO2S/c15-12-7-8-14(13(16)10-12)20(18,19)17-9-3-6-11-4-1-2-5-11/h7-8,10-11,17H,1-6,9H2 |
| InChIKey | FEZNFURDWISNFV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.19 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|