C25H36O11 — CID 10601839
pentamethyl (8E)-13-oxocyclopentadec-8-ene-1,1,6,6,11-pentacarboxylate (PubChem CID 10601839) has the molecular formula C25H36O11 and a molecular weight of 512.55 g/mol. Its IUPAC name is pentamethyl (8E)-13-oxocyclopentadec-8-ene-1,1,6,6,11-pentacarboxylate.
| Compound Name | pentamethyl (8E)-13-oxocyclopentadec-8-ene-1,1,6,6,11-pentacarboxylate |
|---|---|
| PubChem CID | 10601839 |
| Molecular Formula | C25H36O11 |
| Molecular Weight | 512.55 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | pentamethyl (8E)-13-oxocyclopentadec-8-ene-1,1,6,6,11-pentacarboxylate |
| SMILES | COC(=O)C1C/C=C/CC(C(=O)OC)(C(=O)OC)CCCCC(C(=O)OC)(C(=O)OC)CCC(=O)C1 |
| InChI | InChI=1S/C25H36O11/c1-32-19(27)17-10-6-7-12-24(20(28)33-2,21(29)34-3)13-8-9-14-25(22(30)35-4,23(31)36-5)15-11-18(26)16-17/h6-7,17H,8-16H2,1-5H3/b7-6+ |
| InChIKey | LRDQMXQYHQWYCE-VOTSOKGWSA-N |
| XLogP | 2.09 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.55 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|