C40H48O14 — CID 100934622
hexamethyl 6,19-dioxotricyclo[21.3.1.110,14]octacosa-1(26),10(28),11,13,23(27),24-hexaene-3,3,8,16,16,21-hexacarboxylate (PubChem CID 100934622) has the molecular formula C40H48O14 and a molecular weight of 752.81 g/mol. Its IUPAC name is hexamethyl 6,19-dioxotricyclo[21.3.1.110,14]octacosa-1(26),10(28),11,13,23(27),24-hexaene-3,3,8,16,16,21-hexacarboxylate.
| Compound Name | hexamethyl 6,19-dioxotricyclo[21.3.1.110,14]octacosa-1(26),10(28),11,13,23(27),24-hexaene-3,3,8,16,16,21-hexacarboxylate |
|---|---|
| PubChem CID | 100934622 |
| Molecular Formula | C40H48O14 |
| Molecular Weight | 752.81 g/mol |
| Exact Mass | 752.30 |
| IUPAC Name | hexamethyl 6,19-dioxotricyclo[21.3.1.110,14]octacosa-1(26),10(28),11,13,23(27),24-hexaene-3,3,8,16,16,21-hexacarboxylate |
| SMILES | COC(=O)C1CC(=O)CCC(C(=O)OC)(C(=O)OC)Cc2cccc(c2)CC(C(=O)OC)CC(=O)CCC(C(=O)OC)(C(=O)OC)Cc2cccc(c2)C1 |
| InChI | InChI=1S/C40H48O14/c1-49-33(43)29-19-25-9-7-11-27(17-25)23-40(37(47)53-5,38(48)54-6)16-14-32(42)22-30(34(44)50-2)20-26-10-8-12-28(18-26)24-39(35(45)51-3,36(46)52-4)15-13-31(41)21-29/h7-12,17-18,29-30H,13-16,19-24H2,1-6H3 |
| InChIKey | JQWDSFWUJFOOMV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 191.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.81 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|