C24H30O2 — CID 141218797
methyl tricyclo[15.3.1.12,6]docosa-1(20),2,4,6(22),17(21),18-hexaene-11-carboxylate (PubChem CID 141218797) has the molecular formula C24H30O2 and a molecular weight of 350.50 g/mol. Its IUPAC name is methyl tricyclo[15.3.1.12,6]docosa-1(20),2,4,6(22),17(21),18-hexaene-11-carboxylate.
| Compound Name | methyl tricyclo[15.3.1.12,6]docosa-1(20),2,4,6(22),17(21),18-hexaene-11-carboxylate |
|---|---|
| PubChem CID | 141218797 |
| Molecular Formula | C24H30O2 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | methyl tricyclo[15.3.1.12,6]docosa-1(20),2,4,6(22),17(21),18-hexaene-11-carboxylate |
| SMILES | COC(=O)C1CCCCCc2cccc(c2)-c2cccc(c2)CCCC1 |
| InChI | InChI=1S/C24H30O2/c1-26-24(25)21-13-4-2-3-9-19-11-7-15-22(17-19)23-16-8-12-20(18-23)10-5-6-14-21/h7-8,11-12,15-18,21H,2-6,9-10,13-14H2,1H3 |
| InChIKey | ZDFTZGWRKMXPNL-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |