C16H26N2O2 — CID 175753812
methyl 8-(2,3,4,5,6,7-hexahydroazocin-8-yl)-2,3,4,5,6,7-hexahydroazocine-5-carboxylate (PubChem CID 175753812) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is methyl 8-(2,3,4,5,6,7-hexahydroazocin-8-yl)-2,3,4,5,6,7-hexahydroazocine-5-carboxylate.
| Compound Name | methyl 8-(2,3,4,5,6,7-hexahydroazocin-8-yl)-2,3,4,5,6,7-hexahydroazocine-5-carboxylate |
|---|---|
| PubChem CID | 175753812 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | methyl 8-(2,3,4,5,6,7-hexahydroazocin-8-yl)-2,3,4,5,6,7-hexahydroazocine-5-carboxylate |
| SMILES | COC(=O)C1CCC/N=C(C2=N/CCCCCC/2)\CC1 |
| InChI | InChI=1S/C16H26N2O2/c1-20-16(19)13-7-6-12-18-15(10-9-13)14-8-4-2-3-5-11-17-14/h13H,2-12H2,1H3/b17-14+,18-15+ |
| InChIKey | LGUUPYLLAOLAFW-CJQREAPYSA-N |
| XLogP | 3.20 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |