C34H34N2O3 — CID 10601997
(4S)-3-[(3R)-3-[3-(dibenzylamino)phenyl]pentanoyl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 10601997) has the molecular formula C34H34N2O3 and a molecular weight of 518.66 g/mol. Its IUPAC name is (4S)-3-[(3R)-3-[3-(dibenzylamino)phenyl]pentanoyl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(3R)-3-[3-(dibenzylamino)phenyl]pentanoyl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10601997 |
| Molecular Formula | C34H34N2O3 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | (4S)-3-[(3R)-3-[3-(dibenzylamino)phenyl]pentanoyl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | CC[C@H](CC(=O)N1C(=O)OC[C@@H]1c1ccccc1)c1cccc(N(Cc2ccccc2)Cc2ccccc2)c1 |
| InChI | InChI=1S/C34H34N2O3/c1-2-28(22-33(37)36-32(25-39-34(36)38)29-17-10-5-11-18-29)30-19-12-20-31(21-30)35(23-26-13-6-3-7-14-26)24-27-15-8-4-9-16-27/h3-21,28,32H,2,22-25H2,1H3/t28-,32-/m1/s1 |
| InChIKey | LXPOWZXZJLUZBJ-AKGWNBJDSA-N |
| XLogP | 7.50 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |