C36H36N2O4 — CID 22940714
2-[(1R)-1-[3-(dibenzylamino)phenyl]propyl]-1-(2-oxo-4-phenyl-1,3-oxazolidin-3-yl)butane-1,3-dione (PubChem CID 22940714) has the molecular formula C36H36N2O4 and a molecular weight of 560.69 g/mol. Its IUPAC name is 2-[(1R)-1-[3-(dibenzylamino)phenyl]propyl]-1-(2-oxo-4-phenyl-1,3-oxazolidin-3-yl)butane-1,3-dione.
| Compound Name | 2-[(1R)-1-[3-(dibenzylamino)phenyl]propyl]-1-(2-oxo-4-phenyl-1,3-oxazolidin-3-yl)butane-1,3-dione |
|---|---|
| PubChem CID | 22940714 |
| Molecular Formula | C36H36N2O4 |
| Molecular Weight | 560.69 g/mol |
| Exact Mass | 560.27 |
| IUPAC Name | 2-[(1R)-1-[3-(dibenzylamino)phenyl]propyl]-1-(2-oxo-4-phenyl-1,3-oxazolidin-3-yl)butane-1,3-dione |
| SMILES | CC[C@@H](c1cccc(N(Cc2ccccc2)Cc2ccccc2)c1)C(C(C)=O)C(=O)N1C(=O)OCC1c1ccccc1 |
| InChI | InChI=1S/C36H36N2O4/c1-3-32(34(26(2)39)35(40)38-33(25-42-36(38)41)29-18-11-6-12-19-29)30-20-13-21-31(22-30)37(23-27-14-7-4-8-15-27)24-28-16-9-5-10-17-28/h4-22,32-34H,3,23-25H2,1-2H3/t32-,33?,34?/m0/s1 |
| InChIKey | OFFBHRASEZKSAB-BGVJURHFSA-N |
| XLogP | 7.31 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.69 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|