C16H17F13O4 — CID 10602032
(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-5-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 10602032) has the molecular formula C16H17F13O4 and a molecular weight of 520.28 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-5-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-5-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 10602032 |
| Molecular Formula | C16H17F13O4 |
| Molecular Weight | 520.28 g/mol |
| Exact Mass | 520.09 |
| IUPAC Name | (3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-5-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | CO[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H17F13O4/c1-10(2)32-8-7(30-3)6(31-9(8)33-10)4-5-11(17,18)12(19,20)13(21,22)14(23,24)15(25,26)16(27,28)29/h6-9H,4-5H2,1-3H3/t6-,7+,8-,9-/m1/s1 |
| InChIKey | LFDZUCPJXRCHMQ-BZNPZCIMSA-N |
| XLogP | 5.40 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.28 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|