C24H46N6O4P2 — CID 10602617
N-[[3-[[(6,9-dimethyl-1,3-dioxa-6,9-diaza-2-phosphacycloundec-2-yl)amino]methyl]phenyl]methyl]-6,9-dimethyl-1,3-dioxa-6,9-diaza-2-phosphacycloundecan-2-amine (PubChem CID 10602617) has the molecular formula C24H46N6O4P2 and a molecular weight of 544.62 g/mol. Its IUPAC name is N-[[3-[[(6,9-dimethyl-1,3-dioxa-6,9-diaza-2-phosphacycloundec-2-yl)amino]methyl]phenyl]methyl]-6,9-dimethyl-1,3-dioxa-6,9-diaza-2-phosphacycloundecan-2-amine.
| Compound Name | N-[[3-[[(6,9-dimethyl-1,3-dioxa-6,9-diaza-2-phosphacycloundec-2-yl)amino]methyl]phenyl]methyl]-6,9-dimethyl-1,3-dioxa-6,9-diaza-2-phosphacycloundecan-2-amine |
|---|---|
| PubChem CID | 10602617 |
| Molecular Formula | C24H46N6O4P2 |
| Molecular Weight | 544.62 g/mol |
| Exact Mass | 544.31 |
| IUPAC Name | N-[[3-[[(6,9-dimethyl-1,3-dioxa-6,9-diaza-2-phosphacycloundec-2-yl)amino]methyl]phenyl]methyl]-6,9-dimethyl-1,3-dioxa-6,9-diaza-2-phosphacycloundecan-2-amine |
| SMILES | CN1CCOP(NCc2cccc(CNP3OCCN(C)CCN(C)CCO3)c2)OCCN(C)CC1 |
| InChI | InChI=1S/C24H46N6O4P2/c1-27-8-9-28(2)13-17-32-35(31-16-12-27)25-21-23-6-5-7-24(20-23)22-26-36-33-18-14-29(3)10-11-30(4)15-19-34-36/h5-7,20,25-26H,8-19,21-22H2,1-4H3 |
| InChIKey | JXNOQLUMOQYPGO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.62 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|