C14H21FN4 — CID 106026408
6-fluoro-N-octan-4-yl-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 106026408) has the molecular formula C14H21FN4 and a molecular weight of 264.35 g/mol. Its IUPAC name is 6-fluoro-N-octan-4-yl-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 6-fluoro-N-octan-4-yl-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 106026408 |
| Molecular Formula | C14H21FN4 |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 6-fluoro-N-octan-4-yl-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | CCCCC(CCC)Nc1nc2ccc(F)cn2n1 |
| InChI | InChI=1S/C14H21FN4/c1-3-5-7-12(6-4-2)16-14-17-13-9-8-11(15)10-19(13)18-14/h8-10,12H,3-7H2,1-2H3,(H,16,18) |
| InChIKey | HMZIYLVSVHEQAT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |