C11H13FN4OS — CID 71973134
N-(6-fluoro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-4-methylsulfanylbutanamide (PubChem CID 71973134) has the molecular formula C11H13FN4OS and a molecular weight of 268.32 g/mol. Its IUPAC name is N-(6-fluoro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-4-methylsulfanylbutanamide.
| Compound Name | N-(6-fluoro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 71973134 |
| Molecular Formula | C11H13FN4OS |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | N-(6-fluoro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)-4-methylsulfanylbutanamide |
| SMILES | CSCCCC(=O)Nc1nc2ccc(F)cn2n1 |
| InChI | InChI=1S/C11H13FN4OS/c1-18-6-2-3-10(17)14-11-13-9-5-4-8(12)7-16(9)15-11/h4-5,7H,2-3,6H2,1H3,(H,14,15,17) |
| InChIKey | WLNJLODDRBKSRG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|