C12H13FN4 — CID 114202601
6-fluoro-N-(4-methylpent-1-yn-3-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 114202601) has the molecular formula C12H13FN4 and a molecular weight of 232.26 g/mol. Its IUPAC name is 6-fluoro-N-(4-methylpent-1-yn-3-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 6-fluoro-N-(4-methylpent-1-yn-3-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 114202601 |
| Molecular Formula | C12H13FN4 |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 6-fluoro-N-(4-methylpent-1-yn-3-yl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | C#CC(Nc1nc2ccc(F)cn2n1)C(C)C |
| InChI | InChI=1S/C12H13FN4/c1-4-10(8(2)3)14-12-15-11-6-5-9(13)7-17(11)16-12/h1,5-8,10H,2-3H3,(H,14,16) |
| InChIKey | RZBHQNORKLCTOA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|