C14H14FN5 — CID 116650552
N-[1-(4-aminophenyl)ethyl]-6-fluoro-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 116650552) has the molecular formula C14H14FN5 and a molecular weight of 271.30 g/mol. Its IUPAC name is N-[1-(4-aminophenyl)ethyl]-6-fluoro-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | N-[1-(4-aminophenyl)ethyl]-6-fluoro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 116650552 |
| Molecular Formula | C14H14FN5 |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | N-[1-(4-aminophenyl)ethyl]-6-fluoro-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | CC(Nc1nc2ccc(F)cn2n1)c1ccc(N)cc1 |
| InChI | InChI=1S/C14H14FN5/c1-9(10-2-5-12(16)6-3-10)17-14-18-13-7-4-11(15)8-20(13)19-14/h2-9H,16H2,1H3,(H,17,19) |
| InChIKey | XFYPVVHTOHEWMS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|