C33H30N2O6 — CID 10602748
(1S,2S,13R,21R)-22-(cyclopropylmethyl)-2-[(3-nitrophenyl)methoxy]-11,14-dioxa-22-azaheptacyclo[13.9.1.01,13.02,21.04,12.05,10.019,25]pentacosa-4(12),5,7,9,15,17,19(25)-heptaen-16-ol (PubChem CID 10602748) has the molecular formula C33H30N2O6 and a molecular weight of 550.61 g/mol. Its IUPAC name is (1S,2S,13R,21R)-22-(cyclopropylmethyl)-2-[(3-nitrophenyl)methoxy]-11,14-dioxa-22-azaheptacyclo[13.9.1.01,13.02,21.04,12.05,10.019,25]pentacosa-4(12),5,7,9,15,17,19(25)-heptaen-16-ol.
| Compound Name | (1S,2S,13R,21R)-22-(cyclopropylmethyl)-2-[(3-nitrophenyl)methoxy]-11,14-dioxa-22-azaheptacyclo[13.9.1.01,13.02,21.04,12.05,10.019,25]pentacosa-4(12),5,7,9,15,17,19(25)-heptaen-16-ol |
|---|---|
| PubChem CID | 10602748 |
| Molecular Formula | C33H30N2O6 |
| Molecular Weight | 550.61 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | (1S,2S,13R,21R)-22-(cyclopropylmethyl)-2-[(3-nitrophenyl)methoxy]-11,14-dioxa-22-azaheptacyclo[13.9.1.01,13.02,21.04,12.05,10.019,25]pentacosa-4(12),5,7,9,15,17,19(25)-heptaen-16-ol |
| SMILES | O=[N+]([O-])c1cccc(CO[C@@]23Cc4c(oc5ccccc45)[C@@H]4Oc5c(O)ccc6c5[C@@]42CCN(CC2CC2)[C@@H]3C6)c1 |
| InChI | InChI=1S/C33H30N2O6/c36-25-11-10-21-15-27-33(39-18-20-4-3-5-22(14-20)35(37)38)16-24-23-6-1-2-7-26(23)40-29(24)31-32(33,28(21)30(25)41-31)12-13-34(27)17-19-8-9-19/h1-7,10-11,14,19,27,31,36H,8-9,12-13,15-18H2/t27-,31+,32+,33-/m1/s1 |
| InChIKey | CTMMBUMXYJBMOA-OUDZLNJNSA-N |
| XLogP | 5.97 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.61 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|