C15H14ClNO2S2 — CID 106042012
N-[2-(5-chlorothiophen-2-yl)ethyl]-5-(3-hydroxyprop-1-ynyl)-4-methylthiophene-2-carboxamide (PubChem CID 106042012) has the molecular formula C15H14ClNO2S2 and a molecular weight of 339.87 g/mol. Its IUPAC name is N-[2-(5-chlorothiophen-2-yl)ethyl]-5-(3-hydroxyprop-1-ynyl)-4-methylthiophene-2-carboxamide.
| Compound Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-5-(3-hydroxyprop-1-ynyl)-4-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 106042012 |
| Molecular Formula | C15H14ClNO2S2 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | N-[2-(5-chlorothiophen-2-yl)ethyl]-5-(3-hydroxyprop-1-ynyl)-4-methylthiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)NCCc2ccc(Cl)s2)sc1C#CCO |
| InChI | InChI=1S/C15H14ClNO2S2/c1-10-9-13(21-12(10)3-2-8-18)15(19)17-7-6-11-4-5-14(16)20-11/h4-5,9,18H,6-8H2,1H3,(H,17,19) |
| InChIKey | CUQQXCNKYYZWAS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|